dibutyl methyl phosphate

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

dibutyl methyl phosphate; phosphoric acid dibutyl methyl ester
Formula:C9H21O4P; 224.24 g/mol
InChiKey:LPRHLAXCXZTKNI-UHFFFAOYSA-N
SMILES:CCCCO[P](=O)(OC)OCCCC
Molecular structure of dibutyl methyl phosphate

Isomers

dibutyl methyl phosphate
Molecular structure of dibutyl methyl phosphate
diethyl pentyl phosphate
Molecular structure of diethyl pentyl phosphate
triisopropyl phosphate
Molecular structure of triisopropyl phosphate
tripropyl phosphate
Molecular structure of tripropyl phosphate
  ::